Nife2o4@Sio2pra/PC-Ni(II) as a highly efficient catalyst for microwave promoted one pot synthesis of tetra substituted imidazoles

چکیده مقاله

A simple and practical microwave irradiation synthetic strategy for preparation of catalyst nanostructured NiFe2O4@SiO2PrA/PC-Ni(II) was developed. The preparation of imidazole derivatives by using this catalyst in the reaction medium is much easier, faster, higher yields, simple separation of products and pure products. The structure of NiFe2O4@SiO2PrA/PC-Ni(II) was characterized by various analyses such as Fourier transform infrared spectroscopy (FTIR), X-ray diffraction (XRD), scanning electron microscopy (SEM), magnetic properties by vibrating sample magnetometer (VSM) and thermogravimetric analysis (TGA). The pure products were identified and characterized by physical and spectroscopic data such as melting point, IR and 1H NMR techniques.