| نویسندگان | عاطفه لیموزاده,حسین نعیمی |
| نشریه | J COORD CHEM |
| شماره صفحات | 1907 |
| شماره مجلد | 73 |
| ضریب تاثیر (IF) | 1.751 |
| نوع مقاله | Full Paper |
| تاریخ انتشار | 2020-08-04 |
| رتبه نشریه | علمی - پژوهشی |
| نوع نشریه | الکترونیکی |
| کشور محل چاپ | ایران |
| نمایه نشریه | JCR |
چکیده مقاله
A simple and practical microwave irradiation synthetic strategy for
preparation of catalyst nanostructured NiFe2O4@SiO2PrA/PC-Ni(II)
was developed. The preparation of imidazole derivatives by using
this catalyst in the reaction medium is much easier, faster, higher
yields, simple separation of products and pure products. The
structure of NiFe2O4@SiO2PrA/PC-Ni(II) was characterized by various
analyses such as Fourier transform infrared spectroscopy (FTIR),
X-ray diffraction (XRD), scanning electron microscopy (SEM),
magnetic properties by vibrating sample magnetometer (VSM)
and thermogravimetric analysis (TGA). The pure products were
identified and characterized by physical and spectroscopic data
such as melting point, IR and 1H NMR techniques.